C19H19N3O6 — CID 46412308
methyl 3-[[3-(2-methylpropanoylamino)phenyl]carbamoyl]-5-nitrobenzoate (PubChem CID 46412308) has the molecular formula C19H19N3O6 and a molecular weight of 385.38 g/mol. Its IUPAC name is methyl 3-[[3-(2-methylpropanoylamino)phenyl]carbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[[3-(2-methylpropanoylamino)phenyl]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 46412308 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | methyl 3-[[3-(2-methylpropanoylamino)phenyl]carbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)Nc2cccc(NC(=O)C(C)C)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N3O6/c1-11(2)17(23)20-14-5-4-6-15(10-14)21-18(24)12-7-13(19(25)28-3)9-16(8-12)22(26)27/h4-11H,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | VRYVQAOUNAAYHK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|