C23H22N6O4S2 — CID 4641260
2,6-dimethyl-3-N,5-N-bis(4-methyl-1,3-thiazol-2-yl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 4641260) has the molecular formula C23H22N6O4S2 and a molecular weight of 510.60 g/mol. Its IUPAC name is 2,6-dimethyl-3-N,5-N-bis(4-methyl-1,3-thiazol-2-yl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 2,6-dimethyl-3-N,5-N-bis(4-methyl-1,3-thiazol-2-yl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 4641260 |
| Molecular Formula | C23H22N6O4S2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 2,6-dimethyl-3-N,5-N-bis(4-methyl-1,3-thiazol-2-yl)-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | CC1=C(C(=O)Nc2nc(C)cs2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)Nc2nc(C)cs2)=C(C)N1 |
| InChI | InChI=1S/C23H22N6O4S2/c1-11-9-34-22(24-11)27-20(30)17-13(3)26-14(4)18(21(31)28-23-25-12(2)10-35-23)19(17)15-6-5-7-16(8-15)29(32)33/h5-10,19,26H,1-4H3,(H,24,27,30)(H,25,28,31) |
| InChIKey | BGRZMIYIOUUUBJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|