C25H34FN3O3S — CID 46413986
N-[2-(diethylamino)-3-phenylpropyl]-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 46413986) has the molecular formula C25H34FN3O3S and a molecular weight of 475.63 g/mol. Its IUPAC name is N-[2-(diethylamino)-3-phenylpropyl]-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-(diethylamino)-3-phenylpropyl]-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46413986 |
| Molecular Formula | C25H34FN3O3S |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | N-[2-(diethylamino)-3-phenylpropyl]-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1)Cc1ccccc1 |
| InChI | InChI=1S/C25H34FN3O3S/c1-3-28(4-2)23(17-20-9-6-5-7-10-20)18-27-25(30)21-11-8-16-29(19-21)33(31,32)24-14-12-22(26)13-15-24/h5-7,9-10,12-15,21,23H,3-4,8,11,16-19H2,1-2H3,(H,27,30) |
| InChIKey | FNGJCIYJPLBLQE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |