About tris(4-methoxy-3,5-dimethylphenyl)phosphane
tris(4-methoxy-3,5-dimethylphenyl)phosphane (PubChem CID 4642096) has the molecular formula C27H33O3P
and a molecular weight of 436.53 g/mol. Its IUPAC name is tris(4-methoxy-3,5-dimethylphenyl)phosphane.
Molecular Properties
| Compound Name | tris(4-methoxy-3,5-dimethylphenyl)phosphane |
| PubChem CID | 4642096 |
| Molecular Formula | C27H33O3P |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | tris(4-methoxy-3,5-dimethylphenyl)phosphane |
| SMILES | COc1c(C)cc(P(c2cc(C)c(OC)c(C)c2)c2cc(C)c(OC)c(C)c2)cc1C |
| InChI | InChI=1S/C27H33O3P/c1-16-10-22(11-17(2)25(16)28-7)31(23-12-18(3)26(29-8)19(4)13-23)24-14-20(5)27(30-9)21(6)15-24/h10-15H,1-9H3 |
| InChIKey | BDGUINGZRGNLPD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(4-methoxy-3,5-dimethylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(4-methoxy-3,5-dimethylphenyl)phosphane?
The IUPAC name of tris(4-methoxy-3,5-dimethylphenyl)phosphane (CID 4642096) is tris(4-methoxy-3,5-dimethylphenyl)phosphane.
What is the SMILES notation for tris(4-methoxy-3,5-dimethylphenyl)phosphane?
The canonical SMILES for tris(4-methoxy-3,5-dimethylphenyl)phosphane is COc1c(C)cc(P(c2cc(C)c(OC)c(C)c2)c2cc(C)c(OC)c(C)c2)cc1C.
What is the InChIKey of tris(4-methoxy-3,5-dimethylphenyl)phosphane?
The InChIKey is BDGUINGZRGNLPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33O3P/c1-16-10-22(11-17(2)25(16)28-7)31(23-12-18(3)26(29-8)19(4)13-23)24-14-20(5)27(30-9)21(6)15-24/h10-15H,1-9H3.
What are the key properties of tris(4-methoxy-3,5-dimethylphenyl)phosphane?
tris(4-methoxy-3,5-dimethylphenyl)phosphane has a molecular weight of 436.53 g/mol, XLogP of 5.32, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris(4-methoxy-3,5-dimethylphenyl)phosphane is sourced from PubChem (CID 4642096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).