About 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate
2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate (PubChem CID 4642129) has the molecular formula C7H11O5-
and a molecular weight of 175.16 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate.
Molecular Properties
| Compound Name | 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate |
| PubChem CID | 4642129 |
| Molecular Formula | C7H11O5- |
| Molecular Weight | 175.16 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate |
| SMILES | CC1(C)OCC(C(O)C(=O)[O-])O1 |
| InChI | InChI=1S/C7H12O5/c1-7(2)11-3-4(12-7)5(8)6(9)10/h4-5,8H,3H2,1-2H3,(H,9,10)/p-1 |
| InChIKey | QJOVXYPGARVTQY-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.16 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate?
The IUPAC name of 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate (CID 4642129) is 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate.
What is the SMILES notation for 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate?
The canonical SMILES for 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate is CC1(C)OCC(C(O)C(=O)[O-])O1.
What is the InChIKey of 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate?
The InChIKey is QJOVXYPGARVTQY-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12O5/c1-7(2)11-3-4(12-7)5(8)6(9)10/h4-5,8H,3H2,1-2H3,(H,9,10)/p-1.
What are the key properties of 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate?
2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate has a molecular weight of 175.16 g/mol, XLogP of -1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate is sourced from PubChem (CID 4642129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).