C22H20FN3O4 — CID 46422246
1-(2-fluoro-4-methylphenyl)-N'-(3-methyl-1-benzofuran-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 46422246) has the molecular formula C22H20FN3O4 and a molecular weight of 409.42 g/mol. Its IUPAC name is 1-(2-fluoro-4-methylphenyl)-N'-(3-methyl-1-benzofuran-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | 1-(2-fluoro-4-methylphenyl)-N'-(3-methyl-1-benzofuran-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 46422246 |
| Molecular Formula | C22H20FN3O4 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 1-(2-fluoro-4-methylphenyl)-N'-(3-methyl-1-benzofuran-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | Cc1ccc(N2CC(C(=O)NNC(=O)c3oc4ccccc4c3C)CC2=O)c(F)c1 |
| InChI | InChI=1S/C22H20FN3O4/c1-12-7-8-17(16(23)9-12)26-11-14(10-19(26)27)21(28)24-25-22(29)20-13(2)15-5-3-4-6-18(15)30-20/h3-9,14H,10-11H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | OCSKULMZZVYTKN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|