C23H22N2O4 — CID 46423944
N-(2,5-dimethoxyphenyl)-1-naphthalen-1-yl-5-oxopyrrolidine-3-carboxamide (PubChem CID 46423944) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-1-naphthalen-1-yl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-1-naphthalen-1-yl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46423944 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-1-naphthalen-1-yl-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2CC(=O)N(c3cccc4ccccc34)C2)c1 |
| InChI | InChI=1S/C23H22N2O4/c1-28-17-10-11-21(29-2)19(13-17)24-23(27)16-12-22(26)25(14-16)20-9-5-7-15-6-3-4-8-18(15)20/h3-11,13,16H,12,14H2,1-2H3,(H,24,27) |
| InChIKey | BNAWQLUWOWHHKJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |