C18H17F3N4O4 — CID 46424299
4-(cyclopropylamino)-3-nitro-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]benzamide (PubChem CID 46424299) has the molecular formula C18H17F3N4O4 and a molecular weight of 410.35 g/mol. Its IUPAC name is 4-(cyclopropylamino)-3-nitro-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]benzamide.
| Compound Name | 4-(cyclopropylamino)-3-nitro-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 46424299 |
| Molecular Formula | C18H17F3N4O4 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 4-(cyclopropylamino)-3-nitro-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]benzamide |
| SMILES | O=C(NCc1cccnc1OCC(F)(F)F)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17F3N4O4/c19-18(20,21)10-29-17-12(2-1-7-22-17)9-23-16(26)11-3-6-14(24-13-4-5-13)15(8-11)25(27)28/h1-3,6-8,13,24H,4-5,9-10H2,(H,23,26) |
| InChIKey | NFSJRALUYQNBOJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|