C25H27N5O2 — CID 46426625
1-ethyl-3-methyl-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-2-oxoquinoxaline-6-carboxamide (PubChem CID 46426625) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-ethyl-3-methyl-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-2-oxoquinoxaline-6-carboxamide.
| Compound Name | 1-ethyl-3-methyl-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-2-oxoquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 46426625 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 1-ethyl-3-methyl-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-2-oxoquinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(C)nc2cc(C(=O)NCCCc3cn(-c4ccccc4)nc3C)ccc21 |
| InChI | InChI=1S/C25H27N5O2/c1-4-29-23-13-12-19(15-22(23)27-18(3)25(29)32)24(31)26-14-8-9-20-16-30(28-17(20)2)21-10-6-5-7-11-21/h5-7,10-13,15-16H,4,8-9,14H2,1-3H3,(H,26,31) |
| InChIKey | IGCGQLJMTJYNAK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|