C19H28FN3O3 — CID 46426648
ethyl N-[1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 46426648) has the molecular formula C19H28FN3O3 and a molecular weight of 365.45 g/mol. Its IUPAC name is ethyl N-[1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 46426648 |
| Molecular Formula | C19H28FN3O3 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | ethyl N-[1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(C(=O)N1CCN(Cc2ccccc2F)CC1)C(C)C |
| InChI | InChI=1S/C19H28FN3O3/c1-4-26-19(25)21-17(14(2)3)18(24)23-11-9-22(10-12-23)13-15-7-5-6-8-16(15)20/h5-8,14,17H,4,9-13H2,1-3H3,(H,21,25) |
| InChIKey | OVBWPGMOYANMJG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |