C22H23ClN4O3S — CID 46427584
4-chloro-3-piperidin-1-ylsulfonyl-N-[2-(pyrazol-1-ylmethyl)phenyl]benzamide (PubChem CID 46427584) has the molecular formula C22H23ClN4O3S and a molecular weight of 458.97 g/mol. Its IUPAC name is 4-chloro-3-piperidin-1-ylsulfonyl-N-[2-(pyrazol-1-ylmethyl)phenyl]benzamide.
| Compound Name | 4-chloro-3-piperidin-1-ylsulfonyl-N-[2-(pyrazol-1-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 46427584 |
| Molecular Formula | C22H23ClN4O3S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 4-chloro-3-piperidin-1-ylsulfonyl-N-[2-(pyrazol-1-ylmethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1Cn1cccn1)c1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C22H23ClN4O3S/c23-19-10-9-17(15-21(19)31(29,30)27-13-4-1-5-14-27)22(28)25-20-8-3-2-7-18(20)16-26-12-6-11-24-26/h2-3,6-12,15H,1,4-5,13-14,16H2,(H,25,28) |
| InChIKey | HFGKCNTXYQBBDD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |