C21H17F4N3O3S — CID 4642840
ethyl 2-[5-hydroxy-3-naphthalen-2-yl-5-(1,1,2,2-tetrafluoroethyl)-4H-pyrazol-1-yl]-1,3-thiazole-4-carboxylate (PubChem CID 4642840) has the molecular formula C21H17F4N3O3S and a molecular weight of 467.44 g/mol. Its IUPAC name is ethyl 2-[5-hydroxy-3-naphthalen-2-yl-5-(1,1,2,2-tetrafluoroethyl)-4H-pyrazol-1-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[5-hydroxy-3-naphthalen-2-yl-5-(1,1,2,2-tetrafluoroethyl)-4H-pyrazol-1-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 4642840 |
| Molecular Formula | C21H17F4N3O3S |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | ethyl 2-[5-hydroxy-3-naphthalen-2-yl-5-(1,1,2,2-tetrafluoroethyl)-4H-pyrazol-1-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(N2N=C(c3ccc4ccccc4c3)CC2(O)C(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C21H17F4N3O3S/c1-2-31-17(29)16-11-32-19(26-16)28-20(30,21(24,25)18(22)23)10-15(27-28)14-8-7-12-5-3-4-6-13(12)9-14/h3-9,11,18,30H,2,10H2,1H3 |
| InChIKey | GLYJZTRVZIQETC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|