About 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide
2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide (PubChem CID 4642908) has the molecular formula C16H14ClF2NO2
and a molecular weight of 325.74 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide.
Molecular Properties
| Compound Name | 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide |
| PubChem CID | 4642908 |
| Molecular Formula | C16H14ClF2NO2 |
| Molecular Weight | 325.74 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide |
| SMILES | O=C(NCCOCc1ccccc1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C16H14ClF2NO2/c17-13-9-15(19)14(18)8-12(13)16(21)20-6-7-22-10-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2,(H,20,21) |
| InChIKey | AYGNXHGWLGOVPL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.74 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide?
The IUPAC name of 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide (CID 4642908) is 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide.
What is the SMILES notation for 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide?
The canonical SMILES for 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide is O=C(NCCOCc1ccccc1)c1cc(F)c(F)cc1Cl.
What is the InChIKey of 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide?
The InChIKey is AYGNXHGWLGOVPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClF2NO2/c17-13-9-15(19)14(18)8-12(13)16(21)20-6-7-22-10-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2,(H,20,21).
What are the key properties of 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide?
2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide has a molecular weight of 325.74 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,5-difluoro-N-(2-phenylmethoxyethyl)benzamide is sourced from PubChem (CID 4642908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).