About bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate
bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate (PubChem CID 4643274) has the molecular formula C36H22O8
and a molecular weight of 582.56 g/mol. Its IUPAC name is bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate |
| PubChem CID | 4643274 |
| Molecular Formula | C36H22O8 |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate |
| SMILES | O=C(Oc1ccc(C(=O)C(=O)c2ccccc2)cc1)c1ccc(C(=O)Oc2ccc(C(=O)C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H22O8/c37-31(23-7-3-1-4-8-23)33(39)25-15-19-29(20-16-25)43-35(41)27-11-13-28(14-12-27)36(42)44-30-21-17-26(18-22-30)34(40)32(38)24-9-5-2-6-10-24/h1-22H |
| InChIKey | NTBUIYGGZIAUFK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate?
The IUPAC name of bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate (CID 4643274) is bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate.
What is the SMILES notation for bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate?
The canonical SMILES for bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate is O=C(Oc1ccc(C(=O)C(=O)c2ccccc2)cc1)c1ccc(C(=O)Oc2ccc(C(=O)C(=O)c3ccccc3)cc2)cc1.
What is the InChIKey of bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate?
The InChIKey is NTBUIYGGZIAUFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H22O8/c37-31(23-7-3-1-4-8-23)33(39)25-15-19-29(20-16-25)43-35(41)27-11-13-28(14-12-27)36(42)44-30-21-17-26(18-22-30)34(40)32(38)24-9-5-2-6-10-24/h1-22H.
What are the key properties of bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate?
bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate has a molecular weight of 582.56 g/mol, XLogP of 6.26, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(2-oxo-2-phenylacetyl)phenyl] benzene-1,4-dicarboxylate is sourced from PubChem (CID 4643274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).