C26H27N3O3 — CID 46432967
3-benzamido-4-methyl-N-[1-[4-(propanoylamino)phenyl]ethyl]benzamide (PubChem CID 46432967) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 3-benzamido-4-methyl-N-[1-[4-(propanoylamino)phenyl]ethyl]benzamide.
| Compound Name | 3-benzamido-4-methyl-N-[1-[4-(propanoylamino)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 46432967 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 3-benzamido-4-methyl-N-[1-[4-(propanoylamino)phenyl]ethyl]benzamide |
| SMILES | CCC(=O)Nc1ccc(C(C)NC(=O)c2ccc(C)c(NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-4-24(30)28-22-14-12-19(13-15-22)18(3)27-26(32)21-11-10-17(2)23(16-21)29-25(31)20-8-6-5-7-9-20/h5-16,18H,4H2,1-3H3,(H,27,32)(H,28,30)(H,29,31) |
| InChIKey | HGRLSJHBIWSDSH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |