C21H28N4O4 — CID 46436703
2-[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N-propan-2-ylbenzamide (PubChem CID 46436703) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N-propan-2-ylbenzamide.
| Compound Name | 2-[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 46436703 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccccc1NC(=O)CN1C(=O)NC2(CCCCC2C)C1=O |
| InChI | InChI=1S/C21H28N4O4/c1-13(2)22-18(27)15-9-4-5-10-16(15)23-17(26)12-25-19(28)21(24-20(25)29)11-7-6-8-14(21)3/h4-5,9-10,13-14H,6-8,11-12H2,1-3H3,(H,22,27)(H,23,26)(H,24,29) |
| InChIKey | BWRZKMCWODULFC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|