C10H6F11NO — CID 4643854
1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-prop-2-enylcyclohexane-1-carboxamide (PubChem CID 4643854) has the molecular formula C10H6F11NO and a molecular weight of 365.14 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-prop-2-enylcyclohexane-1-carboxamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-prop-2-enylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 4643854 |
| Molecular Formula | C10H6F11NO |
| Molecular Weight | 365.14 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-prop-2-enylcyclohexane-1-carboxamide |
| SMILES | C=CCNC(=O)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H6F11NO/c1-2-3-22-4(23)5(11)6(12,13)8(16,17)10(20,21)9(18,19)7(5,14)15/h2H,1,3H2,(H,22,23) |
| InChIKey | XGJPOZIDJSPHDS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.14 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|