C17H22N4O4 — CID 46439877
3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-methyl-N-[(3-nitrophenyl)methyl]propanamide (PubChem CID 46439877) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-methyl-N-[(3-nitrophenyl)methyl]propanamide.
| Compound Name | 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-methyl-N-[(3-nitrophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 46439877 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-methyl-N-[(3-nitrophenyl)methyl]propanamide |
| SMILES | CN(Cc1cccc([N+](=O)[O-])c1)C(=O)CCc1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C17H22N4O4/c1-17(2,3)16-18-14(25-19-16)8-9-15(22)20(4)11-12-6-5-7-13(10-12)21(23)24/h5-7,10H,8-9,11H2,1-4H3 |
| InChIKey | VGZHQZSSQCGBMR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|