C19H19F3N2O4S — CID 46440370
N-[3-[[acetyl(ethyl)amino]methyl]phenyl]-4-(trifluoromethylsulfonyl)benzamide (PubChem CID 46440370) has the molecular formula C19H19F3N2O4S and a molecular weight of 428.43 g/mol. Its IUPAC name is N-[3-[[acetyl(ethyl)amino]methyl]phenyl]-4-(trifluoromethylsulfonyl)benzamide.
| Compound Name | N-[3-[[acetyl(ethyl)amino]methyl]phenyl]-4-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 46440370 |
| Molecular Formula | C19H19F3N2O4S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[3-[[acetyl(ethyl)amino]methyl]phenyl]-4-(trifluoromethylsulfonyl)benzamide |
| SMILES | CCN(Cc1cccc(NC(=O)c2ccc(S(=O)(=O)C(F)(F)F)cc2)c1)C(C)=O |
| InChI | InChI=1S/C19H19F3N2O4S/c1-3-24(13(2)25)12-14-5-4-6-16(11-14)23-18(26)15-7-9-17(10-8-15)29(27,28)19(20,21)22/h4-11H,3,12H2,1-2H3,(H,23,26) |
| InChIKey | KLXXQYOYDTWFMV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |