C21H25N5O — CID 4644254
N-(4-tert-butylphenyl)-4-(5-cyano-2-pyridinyl)piperazine-1-carboxamide (PubChem CID 4644254) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-(5-cyano-2-pyridinyl)piperazine-1-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-4-(5-cyano-2-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 4644254 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-(5-cyano-2-pyridinyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)N2CCN(c3ccc(C#N)cn3)CC2)cc1 |
| InChI | InChI=1S/C21H25N5O/c1-21(2,3)17-5-7-18(8-6-17)24-20(27)26-12-10-25(11-13-26)19-9-4-16(14-22)15-23-19/h4-9,15H,10-13H2,1-3H3,(H,24,27) |
| InChIKey | WPAWIBUDSFBBFI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |