C24H29FN2O3 — CID 46443051
3-(cyclohexanecarbonylamino)-N-[3-(4-fluorophenoxy)propyl]-N-methylbenzamide (PubChem CID 46443051) has the molecular formula C24H29FN2O3 and a molecular weight of 412.51 g/mol. Its IUPAC name is 3-(cyclohexanecarbonylamino)-N-[3-(4-fluorophenoxy)propyl]-N-methylbenzamide.
| Compound Name | 3-(cyclohexanecarbonylamino)-N-[3-(4-fluorophenoxy)propyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 46443051 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 3-(cyclohexanecarbonylamino)-N-[3-(4-fluorophenoxy)propyl]-N-methylbenzamide |
| SMILES | CN(CCCOc1ccc(F)cc1)C(=O)c1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C24H29FN2O3/c1-27(15-6-16-30-22-13-11-20(25)12-14-22)24(29)19-9-5-10-21(17-19)26-23(28)18-7-3-2-4-8-18/h5,9-14,17-18H,2-4,6-8,15-16H2,1H3,(H,26,28) |
| InChIKey | YRZZZRUFSZCTEJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|