C21H30N2O2 — CID 46443319
N-[1-[2-(4-butylphenyl)acetyl]piperidin-4-yl]cyclopropanecarboxamide (PubChem CID 46443319) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is N-[1-[2-(4-butylphenyl)acetyl]piperidin-4-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-[2-(4-butylphenyl)acetyl]piperidin-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46443319 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N-[1-[2-(4-butylphenyl)acetyl]piperidin-4-yl]cyclopropanecarboxamide |
| SMILES | CCCCc1ccc(CC(=O)N2CCC(NC(=O)C3CC3)CC2)cc1 |
| InChI | InChI=1S/C21H30N2O2/c1-2-3-4-16-5-7-17(8-6-16)15-20(24)23-13-11-19(12-14-23)22-21(25)18-9-10-18/h5-8,18-19H,2-4,9-15H2,1H3,(H,22,25) |
| InChIKey | VJTVUILKKMNUSC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |