C15H20N2O3S2 — CID 46443556
3-[(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1,3-thiazolidine-2-thione (PubChem CID 46443556) has the molecular formula C15H20N2O3S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 3-[(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1,3-thiazolidine-2-thione.
| Compound Name | 3-[(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 46443556 |
| Molecular Formula | C15H20N2O3S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 3-[(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1,3-thiazolidine-2-thione |
| SMILES | COc1ccc(OC)c2c1CN(CN1CCSC1=S)CC2O |
| InChI | InChI=1S/C15H20N2O3S2/c1-19-12-3-4-13(20-2)14-10(12)7-16(8-11(14)18)9-17-5-6-22-15(17)21/h3-4,11,18H,5-9H2,1-2H3 |
| InChIKey | KZAKTTDGSJIUQY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|