C18H27N5OS — CID 46443562
N,N-diethyl-4-[(3-methyl-2-sulfanylidenebenzimidazol-1-yl)methyl]piperazine-1-carboxamide (PubChem CID 46443562) has the molecular formula C18H27N5OS and a molecular weight of 361.52 g/mol. Its IUPAC name is N,N-diethyl-4-[(3-methyl-2-sulfanylidenebenzimidazol-1-yl)methyl]piperazine-1-carboxamide.
| Compound Name | N,N-diethyl-4-[(3-methyl-2-sulfanylidenebenzimidazol-1-yl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 46443562 |
| Molecular Formula | C18H27N5OS |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | N,N-diethyl-4-[(3-methyl-2-sulfanylidenebenzimidazol-1-yl)methyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(Cn2c(=S)n(C)c3ccccc32)CC1 |
| InChI | InChI=1S/C18H27N5OS/c1-4-21(5-2)17(24)22-12-10-20(11-13-22)14-23-16-9-7-6-8-15(16)19(3)18(23)25/h6-9H,4-5,10-14H2,1-3H3 |
| InChIKey | JMBYOIZKOWPIHB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 36.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|