About 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide
4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide (PubChem CID 46444049) has the molecular formula C18H15FN2O3
and a molecular weight of 326.33 g/mol. Its IUPAC name is 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide.
Molecular Properties
| Compound Name | 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide |
| PubChem CID | 46444049 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(OCc2coc(-c3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C18H15FN2O3/c1-20-17(22)12-5-7-16(8-6-12)23-10-15-11-24-18(21-15)13-3-2-4-14(19)9-13/h2-9,11H,10H2,1H3,(H,20,22) |
| InChIKey | NOZBZVFPBXSJFZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide?
The IUPAC name of 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide (CID 46444049) is 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide.
What is the SMILES notation for 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide?
The canonical SMILES for 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide is CNC(=O)c1ccc(OCc2coc(-c3cccc(F)c3)n2)cc1.
What is the InChIKey of 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide?
The InChIKey is NOZBZVFPBXSJFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN2O3/c1-20-17(22)12-5-7-16(8-6-12)23-10-15-11-24-18(21-15)13-3-2-4-14(19)9-13/h2-9,11H,10H2,1H3,(H,20,22).
What are the key properties of 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide?
4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide has a molecular weight of 326.33 g/mol, XLogP of 3.42, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]-N-methylbenzamide is sourced from PubChem (CID 46444049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).