C20H24F2N2O3 — CID 46444363
N-[2-(difluoromethoxy)phenyl]-2-[methyl(3-phenoxypropyl)amino]propanamide (PubChem CID 46444363) has the molecular formula C20H24F2N2O3 and a molecular weight of 378.42 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-2-[methyl(3-phenoxypropyl)amino]propanamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-2-[methyl(3-phenoxypropyl)amino]propanamide |
|---|---|
| PubChem CID | 46444363 |
| Molecular Formula | C20H24F2N2O3 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-2-[methyl(3-phenoxypropyl)amino]propanamide |
| SMILES | CC(C(=O)Nc1ccccc1OC(F)F)N(C)CCCOc1ccccc1 |
| InChI | InChI=1S/C20H24F2N2O3/c1-15(24(2)13-8-14-26-16-9-4-3-5-10-16)19(25)23-17-11-6-7-12-18(17)27-20(21)22/h3-7,9-12,15,20H,8,13-14H2,1-2H3,(H,23,25) |
| InChIKey | VXCLUSHTAQVTJU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|