C22H31FN4O3 — CID 46444767
N-(cyclohexylcarbamoyl)-2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]propanamide (PubChem CID 46444767) has the molecular formula C22H31FN4O3 and a molecular weight of 418.51 g/mol. Its IUPAC name is N-(cyclohexylcarbamoyl)-2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]propanamide.
| Compound Name | N-(cyclohexylcarbamoyl)-2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 46444767 |
| Molecular Formula | C22H31FN4O3 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-(cyclohexylcarbamoyl)-2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)NC(=O)NC1CCCCC1)N1CCN(C(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H31FN4O3/c1-16(21(29)25-22(30)24-19-5-3-2-4-6-19)26-11-13-27(14-12-26)20(28)15-17-7-9-18(23)10-8-17/h7-10,16,19H,2-6,11-15H2,1H3,(H2,24,25,29,30) |
| InChIKey | RHWCRHTXEYNPQP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |