C20H24F2N2O2 — CID 46444841
2-[3-(4-fluorophenoxy)propyl-methylamino]-N-[1-(4-fluorophenyl)ethyl]acetamide (PubChem CID 46444841) has the molecular formula C20H24F2N2O2 and a molecular weight of 362.42 g/mol. Its IUPAC name is 2-[3-(4-fluorophenoxy)propyl-methylamino]-N-[1-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[3-(4-fluorophenoxy)propyl-methylamino]-N-[1-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 46444841 |
| Molecular Formula | C20H24F2N2O2 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[3-(4-fluorophenoxy)propyl-methylamino]-N-[1-(4-fluorophenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CN(C)CCCOc1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H24F2N2O2/c1-15(16-4-6-17(21)7-5-16)23-20(25)14-24(2)12-3-13-26-19-10-8-18(22)9-11-19/h4-11,15H,3,12-14H2,1-2H3,(H,23,25) |
| InChIKey | UEIUTOVRNCTOOI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|