C22H31N5O2 — CID 46445438
N-[2-(3-methylphenoxy)ethyl]-4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazine-1-carboxamide (PubChem CID 46445438) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[2-(3-methylphenoxy)ethyl]-4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-[2-(3-methylphenoxy)ethyl]-4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 46445438 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-[2-(3-methylphenoxy)ethyl]-4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(OCCNC(=O)N2CCN(c3cc(C)nc(C(C)C)n3)CC2)c1 |
| InChI | InChI=1S/C22H31N5O2/c1-16(2)21-24-18(4)15-20(25-21)26-9-11-27(12-10-26)22(28)23-8-13-29-19-7-5-6-17(3)14-19/h5-7,14-16H,8-13H2,1-4H3,(H,23,28) |
| InChIKey | HJEFTTAFMNPACG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|