C20H25NO4 — CID 46448861
2-(2,4-dimethoxyphenyl)-N-[3-(3-methylphenoxy)propyl]acetamide (PubChem CID 46448861) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-[3-(3-methylphenoxy)propyl]acetamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-[3-(3-methylphenoxy)propyl]acetamide |
|---|---|
| PubChem CID | 46448861 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-[3-(3-methylphenoxy)propyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCCCOc2cccc(C)c2)c(OC)c1 |
| InChI | InChI=1S/C20H25NO4/c1-15-6-4-7-18(12-15)25-11-5-10-21-20(22)13-16-8-9-17(23-2)14-19(16)24-3/h4,6-9,12,14H,5,10-11,13H2,1-3H3,(H,21,22) |
| InChIKey | FWCADFBYMVHWJB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|