About 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine
1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine (PubChem CID 4644899) has the molecular formula C24H21N
and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine.
Molecular Properties
| Compound Name | 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine |
| PubChem CID | 4644899 |
| Molecular Formula | C24H21N |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine |
| SMILES | Cc1cc(C)c(/N=C/c2c3ccccc3cc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C24H21N/c1-16-12-17(2)24(18(3)13-16)25-15-23-21-10-6-4-8-19(21)14-20-9-5-7-11-22(20)23/h4-15H,1-3H3/b25-15+ |
| InChIKey | XVQJQIMQTXPCIG-MFKUBSTISA-N |
| XLogP | 6.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine?
The IUPAC name of 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine (CID 4644899) is 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine.
What is the SMILES notation for 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine?
The canonical SMILES for 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine is Cc1cc(C)c(/N=C/c2c3ccccc3cc3ccccc23)c(C)c1.
What is the InChIKey of 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine?
The InChIKey is XVQJQIMQTXPCIG-MFKUBSTISA-N. The full InChI is InChI=1S/C24H21N/c1-16-12-17(2)24(18(3)13-16)25-15-23-21-10-6-4-8-19(21)14-20-9-5-7-11-22(20)23/h4-15H,1-3H3/b25-15+.
What are the key properties of 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine?
1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine has a molecular weight of 323.44 g/mol, XLogP of 6.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anthracen-9-yl-N-(2,4,6-trimethylphenyl)methanimine is sourced from PubChem (CID 4644899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).