About [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone
[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone (PubChem CID 46449097) has the molecular formula C22H23N3O2S
and a molecular weight of 393.51 g/mol. Its IUPAC name is [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone |
| PubChem CID | 46449097 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone |
| SMILES | Cc1nc(CSc2ccccc2C(=O)N2CCC(c3ccccc3)CC2)no1 |
| InChI | InChI=1S/C22H23N3O2S/c1-16-23-21(24-27-16)15-28-20-10-6-5-9-19(20)22(26)25-13-11-18(12-14-25)17-7-3-2-4-8-17/h2-10,18H,11-15H2,1H3 |
| InChIKey | KSQUQFZALUBZLB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone?
The IUPAC name of [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone (CID 46449097) is [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone.
What is the SMILES notation for [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone?
The canonical SMILES for [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone is Cc1nc(CSc2ccccc2C(=O)N2CCC(c3ccccc3)CC2)no1.
What is the InChIKey of [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone?
The InChIKey is KSQUQFZALUBZLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O2S/c1-16-23-21(24-27-16)15-28-20-10-6-5-9-19(20)22(26)25-13-11-18(12-14-25)17-7-3-2-4-8-17/h2-10,18H,11-15H2,1H3.
What are the key properties of [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone?
[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone has a molecular weight of 393.51 g/mol, XLogP of 4.69, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]-(4-phenylpiperidin-1-yl)methanone is sourced from PubChem (CID 46449097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).