C16H21NO3 — CID 46449818
N-[cyclopropyl-(4-methoxyphenyl)methyl]oxolane-2-carboxamide (PubChem CID 46449818) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[cyclopropyl-(4-methoxyphenyl)methyl]oxolane-2-carboxamide.
| Compound Name | N-[cyclopropyl-(4-methoxyphenyl)methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 46449818 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[cyclopropyl-(4-methoxyphenyl)methyl]oxolane-2-carboxamide |
| SMILES | COc1ccc(C(NC(=O)C2CCCO2)C2CC2)cc1 |
| InChI | InChI=1S/C16H21NO3/c1-19-13-8-6-12(7-9-13)15(11-4-5-11)17-16(18)14-3-2-10-20-14/h6-9,11,14-15H,2-5,10H2,1H3,(H,17,18) |
| InChIKey | GUHMMIKBHKSARH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |