C20H22N2O3S — CID 46450259
N-cyclopropyl-1-(4-methoxyphenyl)-5-oxo-N-(thiophen-2-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 46450259) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-cyclopropyl-1-(4-methoxyphenyl)-5-oxo-N-(thiophen-2-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-cyclopropyl-1-(4-methoxyphenyl)-5-oxo-N-(thiophen-2-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46450259 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-cyclopropyl-1-(4-methoxyphenyl)-5-oxo-N-(thiophen-2-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2CC(C(=O)N(Cc3cccs3)C3CC3)CC2=O)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-25-17-8-6-15(7-9-17)21-12-14(11-19(21)23)20(24)22(16-4-5-16)13-18-3-2-10-26-18/h2-3,6-10,14,16H,4-5,11-13H2,1H3 |
| InChIKey | YZGDBOWEFHEPEC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |