C23H23NO4 — CID 46450815
2-[(3-methoxyphenyl)methoxy]-N-(2-phenoxyphenyl)propanamide (PubChem CID 46450815) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methoxy]-N-(2-phenoxyphenyl)propanamide.
| Compound Name | 2-[(3-methoxyphenyl)methoxy]-N-(2-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 46450815 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-[(3-methoxyphenyl)methoxy]-N-(2-phenoxyphenyl)propanamide |
| SMILES | COc1cccc(COC(C)C(=O)Nc2ccccc2Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H23NO4/c1-17(27-16-18-9-8-12-20(15-18)26-2)23(25)24-21-13-6-7-14-22(21)28-19-10-4-3-5-11-19/h3-15,17H,16H2,1-2H3,(H,24,25) |
| InChIKey | RRGMXEDPGIGOPF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |