C15H22N4OS2 — CID 46450898
4-methyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-2-propan-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 46450898) has the molecular formula C15H22N4OS2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 4-methyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-2-propan-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-2-propan-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46450898 |
| Molecular Formula | C15H22N4OS2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-methyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-2-propan-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)c2sc(C(C)C)nc2C)s1 |
| InChI | InChI=1S/C15H22N4OS2/c1-5-6-7-8-11-18-19-15(21-11)17-13(20)12-10(4)16-14(22-12)9(2)3/h9H,5-8H2,1-4H3,(H,17,19,20) |
| InChIKey | JMFSFNFRNWGMEU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|