About 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone
1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone (PubChem CID 4645686) has the molecular formula C11H8BrN3OS
and a molecular weight of 310.18 g/mol. Its IUPAC name is 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone |
| PubChem CID | 4645686 |
| Molecular Formula | C11H8BrN3OS |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone |
| SMILES | CC(=O)n1c2ccc(Br)cc2c2[nH]c(=S)[nH]c21 |
| InChI | InChI=1S/C11H8BrN3OS/c1-5(16)15-8-3-2-6(12)4-7(8)9-10(15)14-11(17)13-9/h2-4H,1H3,(H2,13,14,17) |
| InChIKey | NIBLLAVZGQGAJV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_urea_P(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone?
The IUPAC name of 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone (CID 4645686) is 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone.
What is the SMILES notation for 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone?
The canonical SMILES for 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone is CC(=O)n1c2ccc(Br)cc2c2[nH]c(=S)[nH]c21.
What is the InChIKey of 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone?
The InChIKey is NIBLLAVZGQGAJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrN3OS/c1-5(16)15-8-3-2-6(12)4-7(8)9-10(15)14-11(17)13-9/h2-4H,1H3,(H2,13,14,17).
What are the key properties of 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone?
1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone has a molecular weight of 310.18 g/mol, XLogP of 3.60, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-bromo-2-sulfanylidene-1,3-dihydroimidazo[4,5-b]indol-4-yl)ethanone is sourced from PubChem (CID 4645686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).