C17H23ClO6 — CID 4645769
[10-hydroxy-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] 2-chloroacetate (PubChem CID 4645769) has the molecular formula C17H23ClO6 and a molecular weight of 358.82 g/mol. Its IUPAC name is [10-hydroxy-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] 2-chloroacetate.
| Compound Name | [10-hydroxy-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 4645769 |
| Molecular Formula | C17H23ClO6 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [10-hydroxy-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] 2-chloroacetate |
| SMILES | CC1=CC2OC3C(O)C(OC(=O)CCl)C(C)(C2(CO)CC1)C31CO1 |
| InChI | InChI=1S/C17H23ClO6/c1-9-3-4-16(7-19)10(5-9)23-14-12(21)13(24-11(20)6-18)15(16,2)17(14)8-22-17/h5,10,12-14,19,21H,3-4,6-8H2,1-2H3 |
| InChIKey | NKCJHBQJGPSCTL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|