C19H23F3N4O5S — CID 46458309
1-ethyl-4-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]piperazine-2,3-dione (PubChem CID 46458309) has the molecular formula C19H23F3N4O5S and a molecular weight of 476.48 g/mol. Its IUPAC name is 1-ethyl-4-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]piperazine-2,3-dione.
| Compound Name | 1-ethyl-4-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 46458309 |
| Molecular Formula | C19H23F3N4O5S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 1-ethyl-4-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethyl]piperazine-2,3-dione |
| SMILES | CCN1CCN(CC(=O)N2CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)C(=O)C1=O |
| InChI | InChI=1S/C19H23F3N4O5S/c1-2-23-6-7-25(18(29)17(23)28)13-16(27)24-8-10-26(11-9-24)32(30,31)15-5-3-4-14(12-15)19(20,21)22/h3-5,12H,2,6-11,13H2,1H3 |
| InChIKey | AABDPRKPNFVVCL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|