C11H13N3O3 — CID 4645851
N'-[1-(4-hydroxyphenyl)propylideneamino]oxamide (PubChem CID 4645851) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is N'-[1-(4-hydroxyphenyl)propylideneamino]oxamide.
| Compound Name | N'-[1-(4-hydroxyphenyl)propylideneamino]oxamide |
|---|---|
| PubChem CID | 4645851 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N'-[1-(4-hydroxyphenyl)propylideneamino]oxamide |
| SMILES | CCC(=NNC(=O)C(N)=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H13N3O3/c1-2-9(13-14-11(17)10(12)16)7-3-5-8(15)6-4-7/h3-6,15H,2H2,1H3,(H2,12,16)(H,14,17) |
| InChIKey | CZLBDCMWVHTSEF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|