C22H24N4O4 — CID 46458881
[2-oxo-2-(2-phenoxyethylamino)ethyl] 5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carboxylate (PubChem CID 46458881) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is [2-oxo-2-(2-phenoxyethylamino)ethyl] 5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carboxylate.
| Compound Name | [2-oxo-2-(2-phenoxyethylamino)ethyl] 5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 46458881 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [2-oxo-2-(2-phenoxyethylamino)ethyl] 5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carboxylate |
| SMILES | CC(C)c1c(C(=O)OCC(=O)NCCOc2ccccc2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C22H24N4O4/c1-16(2)21-18(14-25-26(21)19-10-6-7-11-23-19)22(28)30-15-20(27)24-12-13-29-17-8-4-3-5-9-17/h3-11,14,16H,12-13,15H2,1-2H3,(H,24,27) |
| InChIKey | YEBJODCCWJTVPE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|