C24H29NO4 — CID 4646356
bis(prop-2-enyl) 2,6-dimethyl-4-(4-propan-2-ylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 4646356) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is bis(prop-2-enyl) 2,6-dimethyl-4-(4-propan-2-ylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 2,6-dimethyl-4-(4-propan-2-ylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 4646356 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | bis(prop-2-enyl) 2,6-dimethyl-4-(4-propan-2-ylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | C=CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC=C)C1c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-7-13-28-23(26)20-16(5)25-17(6)21(24(27)29-14-8-2)22(20)19-11-9-18(10-12-19)15(3)4/h7-12,15,22,25H,1-2,13-14H2,3-6H3 |
| InChIKey | JAIWOMOJQVUXQD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|