About 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide
2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide (PubChem CID 4646568) has the molecular formula C13H12N4O4
and a molecular weight of 288.26 g/mol. Its IUPAC name is 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide.
Molecular Properties
| Compound Name | 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide |
| PubChem CID | 4646568 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide |
| SMILES | O=C(NNC(=O)c1ccco1)C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C13H12N4O4/c18-11(10-7-4-8-21-10)15-17-13(20)12(19)16-14-9-5-2-1-3-6-9/h1-8,14H,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | BBNDICVSHNBJLK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide?
The IUPAC name of 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide (CID 4646568) is 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide.
What is the SMILES notation for 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide?
The canonical SMILES for 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide is O=C(NNC(=O)c1ccco1)C(=O)NNc1ccccc1.
What is the InChIKey of 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide?
The InChIKey is BBNDICVSHNBJLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O4/c18-11(10-7-4-8-21-10)15-17-13(20)12(19)16-14-9-5-2-1-3-6-9/h1-8,14H,(H,15,18)(H,16,19)(H,17,20).
What are the key properties of 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide?
2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide has a molecular weight of 288.26 g/mol, XLogP of 0.18, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N'-(furan-2-carbonyl)-1-N'-phenylethanedihydrazide is sourced from PubChem (CID 4646568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).