About 2-cyclopentylpiperidine
2-cyclopentylpiperidine (PubChem CID 4646584) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 2-cyclopentylpiperidine.
Molecular Properties
| Compound Name | 2-cyclopentylpiperidine |
| PubChem CID | 4646584 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 2-cyclopentylpiperidine |
| SMILES | C1CCC(C2CCCC2)NC1 |
| InChI | InChI=1S/C10H19N/c1-2-6-9(5-1)10-7-3-4-8-11-10/h9-11H,1-8H2 |
| InChIKey | IXTALOBLEDXRNT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopentylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylpiperidine?
The IUPAC name of 2-cyclopentylpiperidine (CID 4646584) is 2-cyclopentylpiperidine.
What is the SMILES notation for 2-cyclopentylpiperidine?
The canonical SMILES for 2-cyclopentylpiperidine is C1CCC(C2CCCC2)NC1.
What is the InChIKey of 2-cyclopentylpiperidine?
The InChIKey is IXTALOBLEDXRNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-2-6-9(5-1)10-7-3-4-8-11-10/h9-11H,1-8H2.
What are the key properties of 2-cyclopentylpiperidine?
2-cyclopentylpiperidine has a molecular weight of 153.27 g/mol, XLogP of 2.32, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylpiperidine is sourced from PubChem (CID 4646584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).