C23H24N4O4 — CID 46468087
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-[4-(3-oxopiperazin-1-yl)phenyl]benzamide (PubChem CID 46468087) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-[4-(3-oxopiperazin-1-yl)phenyl]benzamide.
| Compound Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-[4-(3-oxopiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 46468087 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-[4-(3-oxopiperazin-1-yl)phenyl]benzamide |
| SMILES | Cc1noc(C)c1COc1ccc(C(=O)Nc2ccc(N3CCNC(=O)C3)cc2)cc1 |
| InChI | InChI=1S/C23H24N4O4/c1-15-21(16(2)31-26-15)14-30-20-9-3-17(4-10-20)23(29)25-18-5-7-19(8-6-18)27-12-11-24-22(28)13-27/h3-10H,11-14H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | GTUGFFHYURDSMM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|