C18H15ClN2O2S — CID 46470172
5-chloro-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 46470172) has the molecular formula C18H15ClN2O2S and a molecular weight of 358.85 g/mol. Its IUPAC name is 5-chloro-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46470172 |
| Molecular Formula | C18H15ClN2O2S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 5-chloro-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1cccc(OCc2ccccn2)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H15ClN2O2S/c19-17-8-7-16(24-17)18(22)21-11-13-4-3-6-15(10-13)23-12-14-5-1-2-9-20-14/h1-10H,11-12H2,(H,21,22) |
| InChIKey | FRYJCJQKKMKDCU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |