C23H24N2O4 — CID 46470414
N-[3-[[3-(furan-2-ylmethoxymethyl)phenyl]methylamino]-3-oxopropyl]benzamide (PubChem CID 46470414) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[3-[[3-(furan-2-ylmethoxymethyl)phenyl]methylamino]-3-oxopropyl]benzamide.
| Compound Name | N-[3-[[3-(furan-2-ylmethoxymethyl)phenyl]methylamino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 46470414 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[3-[[3-(furan-2-ylmethoxymethyl)phenyl]methylamino]-3-oxopropyl]benzamide |
| SMILES | O=C(CCNC(=O)c1ccccc1)NCc1cccc(COCc2ccco2)c1 |
| InChI | InChI=1S/C23H24N2O4/c26-22(11-12-24-23(27)20-8-2-1-3-9-20)25-15-18-6-4-7-19(14-18)16-28-17-21-10-5-13-29-21/h1-10,13-14H,11-12,15-17H2,(H,24,27)(H,25,26) |
| InChIKey | RHVHVGDOASGTQT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |