C24H33N3O6S — CID 46472335
2-methoxyethyl 5-[[3-(azepan-1-ylsulfonyl)-4-methylphenyl]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 46472335) has the molecular formula C24H33N3O6S and a molecular weight of 491.61 g/mol. Its IUPAC name is 2-methoxyethyl 5-[[3-(azepan-1-ylsulfonyl)-4-methylphenyl]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | 2-methoxyethyl 5-[[3-(azepan-1-ylsulfonyl)-4-methylphenyl]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 46472335 |
| Molecular Formula | C24H33N3O6S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2-methoxyethyl 5-[[3-(azepan-1-ylsulfonyl)-4-methylphenyl]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | COCCOC(=O)c1c(C)[nH]c(C(=O)Nc2ccc(C)c(S(=O)(=O)N3CCCCCC3)c2)c1C |
| InChI | InChI=1S/C24H33N3O6S/c1-16-9-10-19(15-20(16)34(30,31)27-11-7-5-6-8-12-27)26-23(28)22-17(2)21(18(3)25-22)24(29)33-14-13-32-4/h9-10,15,25H,5-8,11-14H2,1-4H3,(H,26,28) |
| InChIKey | PZIQKZQWOBBWBE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|