C22H15FN4O2S — CID 4647446
N-[(4-fluorophenyl)methylideneamino]-4-(3-nitrophenyl)-3-phenyl-1,3-thiazol-2-imine (PubChem CID 4647446) has the molecular formula C22H15FN4O2S and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methylideneamino]-4-(3-nitrophenyl)-3-phenyl-1,3-thiazol-2-imine.
| Compound Name | N-[(4-fluorophenyl)methylideneamino]-4-(3-nitrophenyl)-3-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4647446 |
| Molecular Formula | C22H15FN4O2S |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-[(4-fluorophenyl)methylideneamino]-4-(3-nitrophenyl)-3-phenyl-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1cccc(-c2csc(=NN=Cc3ccc(F)cc3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C22H15FN4O2S/c23-18-11-9-16(10-12-18)14-24-25-22-26(19-6-2-1-3-7-19)21(15-30-22)17-5-4-8-20(13-17)27(28)29/h1-15H |
| InChIKey | WBVBLQGLAFWIFD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|