C21H17F3N2O3 — CID 46475730
N-[(2-phenylmethoxy-4-pyridinyl)methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 46475730) has the molecular formula C21H17F3N2O3 and a molecular weight of 402.37 g/mol. Its IUPAC name is N-[(2-phenylmethoxy-4-pyridinyl)methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[(2-phenylmethoxy-4-pyridinyl)methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 46475730 |
| Molecular Formula | C21H17F3N2O3 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[(2-phenylmethoxy-4-pyridinyl)methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCc1ccnc(OCc2ccccc2)c1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H17F3N2O3/c22-21(23,24)29-18-8-6-17(7-9-18)20(27)26-13-16-10-11-25-19(12-16)28-14-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,26,27) |
| InChIKey | AIVFVMFZEQDLQB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |